C63H59N — CID 177067734
6,8-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-diphenylfluoren-1-amine (PubChem CID 177067734) has the molecular formula C63H59N and a molecular weight of 830.17 g/mol. Its IUPAC name is 6,8-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-diphenylfluoren-1-amine.
| Compound Name | 6,8-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-diphenylfluoren-1-amine |
|---|---|
| PubChem CID | 177067734 |
| Molecular Formula | C63H59N |
| Molecular Weight | 830.17 g/mol |
| Exact Mass | 829.46 |
| IUPAC Name | 6,8-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-diphenylfluoren-1-amine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C(c1ccccc1)(c1ccccc1)c1c-2cccc1N(c1ccc2c(c1)C(C)(C)c1ccccc1-2)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C63H59N/c1-59(2,3)42-36-50-49-28-21-31-56(58(49)63(40-22-13-11-14-23-40,41-24-15-12-16-25-41)57(50)55(37-42)60(4,5)6)64(43-32-34-47-45-26-17-19-29-51(45)61(7,8)53(47)38-43)44-33-35-48-46-27-18-20-30-52(46)62(9,10)54(48)39-44/h11-39H,1-10H3 |
| InChIKey | YWGSPFGVVNMLIK-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.17 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |