C44H47N — CID 177067969
6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-phenylfluoren-4-amine (PubChem CID 177067969) has the molecular formula C44H47N and a molecular weight of 589.87 g/mol. Its IUPAC name is 6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-phenylfluoren-4-amine.
| Compound Name | 6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-phenylfluoren-4-amine |
|---|---|
| PubChem CID | 177067969 |
| Molecular Formula | C44H47N |
| Molecular Weight | 589.87 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | 6,8-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-phenylfluoren-4-amine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C(C)(C)c1cccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c1-2 |
| InChI | InChI=1S/C44H47N/c1-41(2,3)28-25-33-39-35(44(9,10)40(33)37(26-28)42(4,5)6)21-16-22-38(39)45(29-17-12-11-13-18-29)30-23-24-32-31-19-14-15-20-34(31)43(7,8)36(32)27-30/h11-27H,1-10H3 |
| InChIKey | IUJPDJKFFKNLBP-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.87 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |