C59H57NO — CID 176821650
2,4-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[2,3-b][1]benzofuran-11-amine (PubChem CID 176821650) has the molecular formula C59H57NO and a molecular weight of 796.11 g/mol. Its IUPAC name is 2,4-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[2,3-b][1]benzofuran-11-amine.
| Compound Name | 2,4-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[2,3-b][1]benzofuran-11-amine |
|---|---|
| PubChem CID | 176821650 |
| Molecular Formula | C59H57NO |
| Molecular Weight | 796.11 g/mol |
| Exact Mass | 795.44 |
| IUPAC Name | 2,4-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[2,3-b][1]benzofuran-11-amine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc3cc4c(cc3c2c1)-c1c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cccc1C4(C)C |
| InChI | InChI=1S/C59H57NO/c1-55(2,3)34-28-42-41-32-43-49(33-52(41)61-54(42)50(29-34)56(4,5)6)59(11,12)46-22-17-23-51(53(43)46)60(35-24-26-39-37-18-13-15-20-44(37)57(7,8)47(39)30-35)36-25-27-40-38-19-14-16-21-45(38)58(9,10)48(40)31-36/h13-33H,1-12H3 |
| InChIKey | MITDIHYYISAHQZ-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.11 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |