C63H57N — CID 142508986
2',7'-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9'-spirobi[fluorene]-1-amine (PubChem CID 142508986) has the molecular formula C63H57N and a molecular weight of 828.16 g/mol. Its IUPAC name is 2',7'-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9'-spirobi[fluorene]-1-amine.
| Compound Name | 2',7'-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9'-spirobi[fluorene]-1-amine |
|---|---|
| PubChem CID | 142508986 |
| Molecular Formula | C63H57N |
| Molecular Weight | 828.16 g/mol |
| Exact Mass | 827.45 |
| IUPAC Name | 2',7'-ditert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9'-spirobi[fluorene]-1-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3cc(C(C)(C)C)ccc3-2)c2ccccc2-c2cccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c21 |
| InChI | InChI=1S/C63H57N/c1-59(2,3)38-26-30-47-48-31-27-39(60(4,5)6)35-56(48)63(55(47)34-38)52-24-16-13-20-44(52)49-21-17-25-57(58(49)63)64(40-28-32-45-42-18-11-14-22-50(42)61(7,8)53(45)36-40)41-29-33-46-43-19-12-15-23-51(43)62(9,10)54(46)37-41/h11-37H,1-10H3 |
| InChIKey | CKPTUCHEQOKQLD-UHFFFAOYSA-N |
| XLogP | 16.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.16 |
| LogP ≤ 5 | 16.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |