C81H75NO — CID 174284182
2',7'-ditert-butyl-N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[fluorene-9,9'-xanthene]-2-amine (PubChem CID 174284182) has the molecular formula C81H75NO and a molecular weight of 1078.50 g/mol. Its IUPAC name is 2',7'-ditert-butyl-N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[fluorene-9,9'-xanthene]-2-amine.
| Compound Name | 2',7'-ditert-butyl-N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[fluorene-9,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 174284182 |
| Molecular Formula | C81H75NO |
| Molecular Weight | 1078.50 g/mol |
| Exact Mass | 1077.58 |
| IUPAC Name | 2',7'-ditert-butyl-N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[fluorene-9,9'-xanthene]-2-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3cc(C(C)(C)C)ccc3O2)c2ccccc2-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C3(c5ccccc5-4)c4cc(C(C)(C)C)ccc4-c4ccc(C(C)(C)C)cc43)cc21 |
| InChI | InChI=1S/C81H75NO/c1-75(2,3)48-27-34-59-60-35-28-49(76(4,5)6)42-68(60)80(67(59)41-48)64-25-19-16-22-56(64)61-37-32-53(46-69(61)80)82(52-31-36-58-55-21-15-18-24-63(55)79(13,14)66(58)45-52)54-33-38-62-57-23-17-20-26-65(57)81(70(62)47-54)71-43-50(77(7,8)9)29-39-73(71)83-74-40-30-51(44-72(74)81)78(10,11)12/h15-47H,1-14H3 |
| InChIKey | BHZYYMYHWNCBGY-UHFFFAOYSA-N |
| XLogP | 21.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.50 |
| LogP ≤ 5 | 21.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |