C73H61NOS — CID 174285355
N-(2,7-ditert-butylspiro[fluorene-9,9'-thioxanthene]-2'-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-diphenylxanthen-2-amine (PubChem CID 174285355) has the molecular formula C73H61NOS and a molecular weight of 1000.36 g/mol. Its IUPAC name is N-(2,7-ditert-butylspiro[fluorene-9,9'-thioxanthene]-2'-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-diphenylxanthen-2-amine.
| Compound Name | N-(2,7-ditert-butylspiro[fluorene-9,9'-thioxanthene]-2'-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-diphenylxanthen-2-amine |
|---|---|
| PubChem CID | 174285355 |
| Molecular Formula | C73H61NOS |
| Molecular Weight | 1000.36 g/mol |
| Exact Mass | 999.45 |
| IUPAC Name | N-(2,7-ditert-butylspiro[fluorene-9,9'-thioxanthene]-2'-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-diphenylxanthen-2-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3Sc3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4O5)cc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C73H61NOS/c1-69(2,3)48-31-36-55-56-37-32-49(70(4,5)6)42-62(56)73(61(55)41-48)59-28-18-20-30-67(59)76-68-40-35-52(45-64(68)73)74(50-33-38-54-53-25-15-16-26-57(53)71(7,8)60(54)43-50)51-34-39-66-63(44-51)72(46-21-11-9-12-22-46,47-23-13-10-14-24-47)58-27-17-19-29-65(58)75-66/h9-45H,1-8H3 |
| InChIKey | IMGVMPMMSDWUEG-UHFFFAOYSA-N |
| XLogP | 19.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.36 |
| LogP ≤ 5 | 19.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |