C68H61N — CID 177067110
N-[9,9-bis(3-tert-butylphenyl)fluoren-1-yl]-2-tert-butyl-N-phenyl-9,9'-spirobi[fluorene]-2'-amine (PubChem CID 177067110) has the molecular formula C68H61N and a molecular weight of 892.24 g/mol. Its IUPAC name is N-[9,9-bis(3-tert-butylphenyl)fluoren-1-yl]-2-tert-butyl-N-phenyl-9,9'-spirobi[fluorene]-2'-amine.
| Compound Name | N-[9,9-bis(3-tert-butylphenyl)fluoren-1-yl]-2-tert-butyl-N-phenyl-9,9'-spirobi[fluorene]-2'-amine |
|---|---|
| PubChem CID | 177067110 |
| Molecular Formula | C68H61N |
| Molecular Weight | 892.24 g/mol |
| Exact Mass | 891.48 |
| IUPAC Name | N-[9,9-bis(3-tert-butylphenyl)fluoren-1-yl]-2-tert-butyl-N-phenyl-9,9'-spirobi[fluorene]-2'-amine |
| SMILES | CC(C)(C)c1cccc(C2(c3cccc(C(C)(C)C)c3)c3ccccc3-c3cccc(N(c4ccccc4)c4ccc5c(c4)C4(c6ccccc6-5)c5ccccc5-c5ccc(C(C)(C)C)cc54)c32)c1 |
| InChI | InChI=1S/C68H61N/c1-64(2,3)44-22-19-24-47(40-44)67(48-25-20-23-45(41-48)65(4,5)6)57-32-16-15-30-53(57)56-31-21-35-62(63(56)67)69(49-26-11-10-12-27-49)50-37-39-55-52-29-14-18-34-59(52)68(61(55)43-50)58-33-17-13-28-51(58)54-38-36-46(42-60(54)68)66(7,8)9/h10-43H,1-9H3 |
| InChIKey | CWSXSMUJLRIEMY-UHFFFAOYSA-N |
| XLogP | 17.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.24 |
| LogP ≤ 5 | 17.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |