C60H53NO — CID 176751030
7,9-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenylfluoren-9-yl)phenyl]dibenzofuran-2-amine (PubChem CID 176751030) has the molecular formula C60H53NO and a molecular weight of 804.09 g/mol. Its IUPAC name is 7,9-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenylfluoren-9-yl)phenyl]dibenzofuran-2-amine.
| Compound Name | 7,9-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenylfluoren-9-yl)phenyl]dibenzofuran-2-amine |
|---|---|
| PubChem CID | 176751030 |
| Molecular Formula | C60H53NO |
| Molecular Weight | 804.09 g/mol |
| Exact Mass | 803.41 |
| IUPAC Name | 7,9-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenylfluoren-9-yl)phenyl]dibenzofuran-2-amine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)oc1ccc(N(c3ccc(C4(c5ccccc5)c5ccccc5-c5ccccc54)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc12 |
| InChI | InChI=1S/C60H53NO/c1-57(2,3)40-34-53(58(4,5)6)56-48-36-42(31-33-54(48)62-55(56)35-40)61(43-30-32-47-44-20-12-15-23-49(44)59(7,8)52(47)37-43)41-28-26-39(27-29-41)60(38-18-10-9-11-19-38)50-24-16-13-21-45(50)46-22-14-17-25-51(46)60/h9-37H,1-8H3 |
| InChIKey | CPGJQCNPHPIINY-UHFFFAOYSA-N |
| XLogP | 16.32 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.09 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |