C46H41NO — CID 174312877
9-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)dibenzofuran-2-amine (PubChem CID 174312877) has the molecular formula C46H41NO and a molecular weight of 623.84 g/mol. Its IUPAC name is 9-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)dibenzofuran-2-amine.
| Compound Name | 9-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)dibenzofuran-2-amine |
|---|---|
| PubChem CID | 174312877 |
| Molecular Formula | C46H41NO |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | 9-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)dibenzofuran-2-amine |
| SMILES | CC(C)(C)c1cccc2oc3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3c12 |
| InChI | InChI=1S/C46H41NO/c1-44(2,3)38-17-12-18-42-43(38)35-25-28(21-24-41(35)48-42)47(29-19-22-33-31-13-8-10-15-36(31)45(4,5)39(33)26-29)30-20-23-34-32-14-9-11-16-37(32)46(6,7)40(34)27-30/h8-27H,1-7H3 |
| InChIKey | QXZIEQWQFRUZNJ-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |