C35H36O — CID 167063858
1-tert-butyl-7-(4-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzofuran (PubChem CID 167063858) has the molecular formula C35H36O and a molecular weight of 472.67 g/mol. Its IUPAC name is 1-tert-butyl-7-(4-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzofuran.
| Compound Name | 1-tert-butyl-7-(4-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzofuran |
|---|---|
| PubChem CID | 167063858 |
| Molecular Formula | C35H36O |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-tert-butyl-7-(4-tert-butyl-9,9-dimethylfluoren-2-yl)dibenzofuran |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)oc2cccc(C(C)(C)C)c23)cc2c1-c1ccccc1C2(C)C |
| InChI | InChI=1S/C35H36O/c1-33(2,3)26-14-11-15-29-32(26)24-17-16-21(20-30(24)36-29)22-18-27(34(4,5)6)31-23-12-9-10-13-25(23)35(7,8)28(31)19-22/h9-20H,1-8H3 |
| InChIKey | DNCFCGNWVIUVCM-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |