C47H46 — CID 58986902
2,7-ditert-butyl-9,9-dimethyl-4-[4-[4-(4-phenylphenyl)phenyl]phenyl]fluorene (PubChem CID 58986902) has the molecular formula C47H46 and a molecular weight of 610.89 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-4-[4-[4-(4-phenylphenyl)phenyl]phenyl]fluorene.
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-[4-(4-phenylphenyl)phenyl]phenyl]fluorene |
|---|---|
| PubChem CID | 58986902 |
| Molecular Formula | C47H46 |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-[4-(4-phenylphenyl)phenyl]phenyl]fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(-c3ccc(-c4ccc(-c5ccc(-c6ccccc6)cc5)cc4)cc3)c1-2 |
| InChI | InChI=1S/C47H46/c1-45(2,3)38-26-27-40-42(29-38)47(7,8)43-30-39(46(4,5)6)28-41(44(40)43)37-24-22-36(23-25-37)35-20-18-34(19-21-35)33-16-14-32(15-17-33)31-12-10-9-11-13-31/h9-30H,1-8H3 |
| InChIKey | ZJPFWXJDXXKWKY-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |