C61H52 — CID 58511707
2-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)-6,12-dinaphthalen-2-ylchrysene (PubChem CID 58511707) has the molecular formula C61H52 and a molecular weight of 785.09 g/mol. Its IUPAC name is 2-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)-6,12-dinaphthalen-2-ylchrysene.
| Compound Name | 2-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)-6,12-dinaphthalen-2-ylchrysene |
|---|---|
| PubChem CID | 58511707 |
| Molecular Formula | C61H52 |
| Molecular Weight | 785.09 g/mol |
| Exact Mass | 784.41 |
| IUPAC Name | 2-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)-6,12-dinaphthalen-2-ylchrysene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(-c3ccc4c(c3)c(-c3ccc5ccccc5c3)cc3c5ccccc5c(-c5ccc6ccccc6c5)cc43)c1-2 |
| InChI | InChI=1S/C61H52/c1-59(2,3)44-26-28-49-56(33-44)61(7,8)57-34-45(60(4,5)6)32-52(58(49)57)43-25-27-48-53(31-43)51(42-24-22-38-16-10-12-18-40(38)30-42)36-54-47-20-14-13-19-46(47)50(35-55(48)54)41-23-21-37-15-9-11-17-39(37)29-41/h9-36H,1-8H3 |
| InChIKey | USGMAFXUDANCJP-UHFFFAOYSA-N |
| XLogP | 17.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.09 |
| LogP ≤ 5 | 17.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|