C41H42 — CID 58986957
2,7-ditert-butyl-9,9-dimethyl-4-[4-(2-phenylphenyl)phenyl]fluorene (PubChem CID 58986957) has the molecular formula C41H42 and a molecular weight of 534.79 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-4-[4-(2-phenylphenyl)phenyl]fluorene.
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-(2-phenylphenyl)phenyl]fluorene |
|---|---|
| PubChem CID | 58986957 |
| Molecular Formula | C41H42 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-(2-phenylphenyl)phenyl]fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(-c3ccc(-c4ccccc4-c4ccccc4)cc3)c1-2 |
| InChI | InChI=1S/C41H42/c1-39(2,3)30-22-23-34-36(25-30)41(7,8)37-26-31(40(4,5)6)24-35(38(34)37)29-20-18-28(19-21-29)33-17-13-12-16-32(33)27-14-10-9-11-15-27/h9-26H,1-8H3 |
| InChIKey | DGEVMHVNPUKTRK-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |