C22H24S — CID 174786417
4-tert-butyl-1,2-diphenylbenzene;sulfane (PubChem CID 174786417) has the molecular formula C22H24S and a molecular weight of 320.50 g/mol. Its IUPAC name is 4-tert-butyl-1,2-diphenylbenzene;sulfane.
| Compound Name | 4-tert-butyl-1,2-diphenylbenzene;sulfane |
|---|---|
| PubChem CID | 174786417 |
| Molecular Formula | C22H24S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-tert-butyl-1,2-diphenylbenzene;sulfane |
| SMILES | CC(C)(C)c1ccc(-c2ccccc2)c(-c2ccccc2)c1.S |
| InChI | InChI=1S/C22H22.H2S/c1-22(2,3)19-14-15-20(17-10-6-4-7-11-17)21(16-19)18-12-8-5-9-13-18;/h4-16H,1-3H3;1H2 |
| InChIKey | AQHSTWPSTCQJNL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |