C26H30 — CID 174563257
1,4-ditert-butyl-2-(2-phenylphenyl)benzene (PubChem CID 174563257) has the molecular formula C26H30 and a molecular weight of 342.53 g/mol. Its IUPAC name is 1,4-ditert-butyl-2-(2-phenylphenyl)benzene.
| Compound Name | 1,4-ditert-butyl-2-(2-phenylphenyl)benzene |
|---|---|
| PubChem CID | 174563257 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1,4-ditert-butyl-2-(2-phenylphenyl)benzene |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(-c2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H30/c1-25(2,3)20-16-17-24(26(4,5)6)23(18-20)22-15-11-10-14-21(22)19-12-8-7-9-13-19/h7-18H,1-6H3 |
| InChIKey | QGFICMDTWACUPV-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |