C20H26 — CID 166010763
1,2,3,4,5-pentadeuterio-6-(2,5-ditert-butylphenyl)benzene (PubChem CID 166010763) has the molecular formula C20H26 and a molecular weight of 271.46 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-(2,5-ditert-butylphenyl)benzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-(2,5-ditert-butylphenyl)benzene |
|---|---|
| PubChem CID | 166010763 |
| Molecular Formula | C20H26 |
| Molecular Weight | 271.46 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(2,5-ditert-butylphenyl)benzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(C(C)(C)C)ccc2C(C)(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C20H26/c1-19(2,3)16-12-13-18(20(4,5)6)17(14-16)15-10-8-7-9-11-15/h7-14H,1-6H3/i7D,8D,9D,10D,11D |
| InChIKey | VVUICTIRBNKDNM-RAGZBHKVSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |