C34H31N — CID 162698416
N-[4-(4-tert-butylphenyl)phenyl]-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline (PubChem CID 162698416) has the molecular formula C34H31N and a molecular weight of 463.69 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)phenyl]-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline.
| Compound Name | N-[4-(4-tert-butylphenyl)phenyl]-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline |
|---|---|
| PubChem CID | 162698416 |
| Molecular Formula | C34H31N |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)phenyl]-3,5-bis(2,3,4,5,6-pentadeuteriophenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(Nc3ccc(-c4ccc(C(C)(C)C)cc4)cc3)cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2)c([2H])c1[2H] |
| InChI | InChI=1S/C34H31N/c1-34(2,3)31-18-14-27(15-19-31)28-16-20-32(21-17-28)35-33-23-29(25-10-6-4-7-11-25)22-30(24-33)26-12-8-5-9-13-26/h4-24,35H,1-3H3/i4D,5D,6D,7D,8D,9D,10D,11D,12D,13D |
| InChIKey | IURQFCZVZYOVIG-MIPJZDBJSA-N |
| XLogP | 9.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |