C51H54N6 — CID 163749792
4-[4,6-bis[4-(4-tert-butylanilino)phenyl]-1,3,5-triazin-2-yl]-N-(4-tert-butylphenyl)aniline (PubChem CID 163749792) has the molecular formula C51H54N6 and a molecular weight of 751.04 g/mol. Its IUPAC name is 4-[4,6-bis[4-(4-tert-butylanilino)phenyl]-1,3,5-triazin-2-yl]-N-(4-tert-butylphenyl)aniline.
| Compound Name | 4-[4,6-bis[4-(4-tert-butylanilino)phenyl]-1,3,5-triazin-2-yl]-N-(4-tert-butylphenyl)aniline |
|---|---|
| PubChem CID | 163749792 |
| Molecular Formula | C51H54N6 |
| Molecular Weight | 751.04 g/mol |
| Exact Mass | 750.44 |
| IUPAC Name | 4-[4,6-bis[4-(4-tert-butylanilino)phenyl]-1,3,5-triazin-2-yl]-N-(4-tert-butylphenyl)aniline |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(-c3nc(-c4ccc(Nc5ccc(C(C)(C)C)cc5)cc4)nc(-c4ccc(Nc5ccc(C(C)(C)C)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C51H54N6/c1-49(2,3)37-16-28-43(29-17-37)52-40-22-10-34(11-23-40)46-55-47(35-12-24-41(25-13-35)53-44-30-18-38(19-31-44)50(4,5)6)57-48(56-46)36-14-26-42(27-15-36)54-45-32-20-39(21-33-45)51(7,8)9/h10-33,52-54H,1-9H3 |
| InChIKey | LPAHDLUEAYGCCT-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.04 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |