C28H28N2 — CID 58261754
2-(4-tert-butylphenyl)-4,6-bis(4-methylphenyl)pyrimidine (PubChem CID 58261754) has the molecular formula C28H28N2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4,6-bis(4-methylphenyl)pyrimidine.
| Compound Name | 2-(4-tert-butylphenyl)-4,6-bis(4-methylphenyl)pyrimidine |
|---|---|
| PubChem CID | 58261754 |
| Molecular Formula | C28H28N2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4,6-bis(4-methylphenyl)pyrimidine |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C28H28N2/c1-19-6-10-21(11-7-19)25-18-26(22-12-8-20(2)9-13-22)30-27(29-25)23-14-16-24(17-15-23)28(3,4)5/h6-18H,1-5H3 |
| InChIKey | JYFIAVLKPFNZNA-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |