C29H22N2 — CID 129023209
2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)pyrimidine (PubChem CID 129023209) has the molecular formula C29H22N2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)pyrimidine.
| Compound Name | 2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 129023209 |
| Molecular Formula | C29H22N2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)pyrimidine |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)cc(-c3cccc(-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C29H22N2/c1-21-15-17-24(18-16-21)29-30-27(23-11-6-3-7-12-23)20-28(31-29)26-14-8-13-25(19-26)22-9-4-2-5-10-22/h2-20H,1H3 |
| InChIKey | CMEDUGCGYILPBC-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |