C30H24N2 — CID 118345386
4-(4-methylphenyl)-2-[3-(4-methylphenyl)phenyl]-6-phenylpyrimidine (PubChem CID 118345386) has the molecular formula C30H24N2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-[3-(4-methylphenyl)phenyl]-6-phenylpyrimidine.
| Compound Name | 4-(4-methylphenyl)-2-[3-(4-methylphenyl)phenyl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 118345386 |
| Molecular Formula | C30H24N2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4-(4-methylphenyl)-2-[3-(4-methylphenyl)phenyl]-6-phenylpyrimidine |
| SMILES | Cc1ccc(-c2cccc(-c3nc(-c4ccccc4)cc(-c4ccc(C)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C30H24N2/c1-21-11-15-23(16-12-21)26-9-6-10-27(19-26)30-31-28(24-7-4-3-5-8-24)20-29(32-30)25-17-13-22(2)14-18-25/h3-20H,1-2H3 |
| InChIKey | HWNWZMFTFQAHSR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |