C28H21N3 — CID 129023213
2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 129023213) has the molecular formula C28H21N3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 129023213 |
| Molecular Formula | C28H21N3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-(4-methylphenyl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C28H21N3/c1-20-15-17-23(18-16-20)27-29-26(22-11-6-3-7-12-22)30-28(31-27)25-14-8-13-24(19-25)21-9-4-2-5-10-21/h2-19H,1H3 |
| InChIKey | XLBPTROLIQWFMK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |