C34H25N3 — CID 129263613
2-[3-(3-methylphenyl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 129263613) has the molecular formula C34H25N3 and a molecular weight of 475.60 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(3-methylphenyl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 129263613 |
| Molecular Formula | C34H25N3 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-[3-(3-methylphenyl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | Cc1cccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)c2)c1 |
| InChI | InChI=1S/C34H25N3/c1-24-10-8-15-29(22-24)30-16-9-17-31(23-30)34-36-32(27-13-6-3-7-14-27)35-33(37-34)28-20-18-26(19-21-28)25-11-4-2-5-12-25/h2-23H,1H3 |
| InChIKey | BEFKRSXZVOHWOO-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |