C24H21N3 — CID 171058363
2-(3-methylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine (PubChem CID 171058363) has the molecular formula C24H21N3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-(3-methylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3-methylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171058363 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-(3-methylphenyl)-4,6-bis(4-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C24H21N3/c1-16-7-11-19(12-8-16)22-25-23(20-13-9-17(2)10-14-20)27-24(26-22)21-6-4-5-18(3)15-21/h4-15H,1-3H3 |
| InChIKey | FKDPWONLCZERMB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |