C18H15FN2 — CID 154722562
4-fluoro-2-(3-methylphenyl)-6-(4-methylphenyl)pyrimidine (PubChem CID 154722562) has the molecular formula C18H15FN2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-fluoro-2-(3-methylphenyl)-6-(4-methylphenyl)pyrimidine.
| Compound Name | 4-fluoro-2-(3-methylphenyl)-6-(4-methylphenyl)pyrimidine |
|---|---|
| PubChem CID | 154722562 |
| Molecular Formula | C18H15FN2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-fluoro-2-(3-methylphenyl)-6-(4-methylphenyl)pyrimidine |
| SMILES | Cc1ccc(-c2cc(F)nc(-c3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C18H15FN2/c1-12-6-8-14(9-7-12)16-11-17(19)21-18(20-16)15-5-3-4-13(2)10-15/h3-11H,1-2H3 |
| InChIKey | FAVDMZASCHEHQD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |