C25H24N2 — CID 144569166
ethane;4-(3-methylphenyl)-2,6-diphenylpyrimidine (PubChem CID 144569166) has the molecular formula C25H24N2 and a molecular weight of 352.48 g/mol. Its IUPAC name is ethane;4-(3-methylphenyl)-2,6-diphenylpyrimidine.
| Compound Name | ethane;4-(3-methylphenyl)-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 144569166 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethane;4-(3-methylphenyl)-2,6-diphenylpyrimidine |
| SMILES | CC.Cc1cccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H18N2.C2H6/c1-17-9-8-14-20(15-17)22-16-21(18-10-4-2-5-11-18)24-23(25-22)19-12-6-3-7-13-19;1-2/h2-16H,1H3;1-2H3 |
| InChIKey | GETGQWDNVXCBEO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |