C24H21BrN2 — CID 142385026
4-(3-bromophenyl)-2,6-diphenylpyrimidine;ethane (PubChem CID 142385026) has the molecular formula C24H21BrN2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2,6-diphenylpyrimidine;ethane.
| Compound Name | 4-(3-bromophenyl)-2,6-diphenylpyrimidine;ethane |
|---|---|
| PubChem CID | 142385026 |
| Molecular Formula | C24H21BrN2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-(3-bromophenyl)-2,6-diphenylpyrimidine;ethane |
| SMILES | Brc1cccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1.CC |
| InChI | InChI=1S/C22H15BrN2.C2H6/c23-19-13-7-12-18(14-19)21-15-20(16-8-3-1-4-9-16)24-22(25-21)17-10-5-2-6-11-17;1-2/h1-15H;1-2H3 |
| InChIKey | WHWZFQMTRQXCQI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |