C28H19BrN2 — CID 58943669
4-(3-bromo-5-phenylphenyl)-2,6-diphenylpyrimidine (PubChem CID 58943669) has the molecular formula C28H19BrN2 and a molecular weight of 463.38 g/mol. Its IUPAC name is 4-(3-bromo-5-phenylphenyl)-2,6-diphenylpyrimidine.
| Compound Name | 4-(3-bromo-5-phenylphenyl)-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 58943669 |
| Molecular Formula | C28H19BrN2 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-(3-bromo-5-phenylphenyl)-2,6-diphenylpyrimidine |
| SMILES | Brc1cc(-c2ccccc2)cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C28H19BrN2/c29-25-17-23(20-10-4-1-5-11-20)16-24(18-25)27-19-26(21-12-6-2-7-13-21)30-28(31-27)22-14-8-3-9-15-22/h1-19H |
| InChIKey | WBQMQZARORAHHV-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |