C34H23BrN2 — CID 155757935
4-[4-[4-(3-bromophenyl)phenyl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 155757935) has the molecular formula C34H23BrN2 and a molecular weight of 539.48 g/mol. Its IUPAC name is 4-[4-[4-(3-bromophenyl)phenyl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[4-(3-bromophenyl)phenyl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 155757935 |
| Molecular Formula | C34H23BrN2 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 4-[4-[4-(3-bromophenyl)phenyl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | Brc1cccc(-c2ccc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc2)c1 |
| InChI | InChI=1S/C34H23BrN2/c35-31-13-7-12-30(22-31)26-16-14-24(15-17-26)25-18-20-28(21-19-25)33-23-32(27-8-3-1-4-9-27)36-34(37-33)29-10-5-2-6-11-29/h1-23H |
| InChIKey | ZHTQZRYIERZUCR-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |