C18H17BrN2 — CID 142370256
4-bromo-2,6-diphenylpyrimidine;ethane (PubChem CID 142370256) has the molecular formula C18H17BrN2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 4-bromo-2,6-diphenylpyrimidine;ethane.
| Compound Name | 4-bromo-2,6-diphenylpyrimidine;ethane |
|---|---|
| PubChem CID | 142370256 |
| Molecular Formula | C18H17BrN2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-bromo-2,6-diphenylpyrimidine;ethane |
| SMILES | Brc1cc(-c2ccccc2)nc(-c2ccccc2)n1.CC |
| InChI | InChI=1S/C16H11BrN2.C2H6/c17-15-11-14(12-7-3-1-4-8-12)18-16(19-15)13-9-5-2-6-10-13;1-2/h1-11H;1-2H3 |
| InChIKey | BBPPAPLADIMPHX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |