C20H12Br2N4 — CID 15531052
4,6-bis(6-bromo-2-pyridinyl)-2-phenylpyrimidine (PubChem CID 15531052) has the molecular formula C20H12Br2N4 and a molecular weight of 468.15 g/mol. Its IUPAC name is 4,6-bis(6-bromo-2-pyridinyl)-2-phenylpyrimidine.
| Compound Name | 4,6-bis(6-bromo-2-pyridinyl)-2-phenylpyrimidine |
|---|---|
| PubChem CID | 15531052 |
| Molecular Formula | C20H12Br2N4 |
| Molecular Weight | 468.15 g/mol |
| Exact Mass | 465.94 |
| IUPAC Name | 4,6-bis(6-bromo-2-pyridinyl)-2-phenylpyrimidine |
| SMILES | Brc1cccc(-c2cc(-c3cccc(Br)n3)nc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C20H12Br2N4/c21-18-10-4-8-14(23-18)16-12-17(15-9-5-11-19(22)24-15)26-20(25-16)13-6-2-1-3-7-13/h1-12H |
| InChIKey | IIZVGJJWVXAIPN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.15 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|