C32H21BrN4 — CID 154704675
2-(6-bromo-2-pyridinyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 154704675) has the molecular formula C32H21BrN4 and a molecular weight of 541.45 g/mol. Its IUPAC name is 2-(6-bromo-2-pyridinyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(6-bromo-2-pyridinyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 154704675 |
| Molecular Formula | C32H21BrN4 |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 2-(6-bromo-2-pyridinyl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | Brc1cccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)n1 |
| InChI | InChI=1S/C32H21BrN4/c33-29-13-7-12-28(34-29)32-36-30(26-18-14-24(15-19-26)22-8-3-1-4-9-22)35-31(37-32)27-20-16-25(17-21-27)23-10-5-2-6-11-23/h1-21H |
| InChIKey | WWPRRJHHXMHDDP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|