C47H36N4 — CID 121315643
2-[4-[2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 121315643) has the molecular formula C47H36N4 and a molecular weight of 656.83 g/mol. Its IUPAC name is 2-[4-[2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[4-[2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 121315643 |
| Molecular Formula | C47H36N4 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | 2-[4-[2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | CC(C)(c1ccc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1)c1ccc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C47H36N4/c1-47(2,39-27-23-37(24-28-39)45-48-41(33-15-7-3-8-16-33)31-42(49-45)34-17-9-4-10-18-34)40-29-25-38(26-30-40)46-50-43(35-19-11-5-12-20-35)32-44(51-46)36-21-13-6-14-22-36/h3-32H,1-2H3 |
| InChIKey | YSLLTWDBCIKFNT-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |