C41H34N2 — CID 146384699
2-[4-[2-[4-[2-[(1Z)-buta-1,3-dienyl]phenyl]phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 146384699) has the molecular formula C41H34N2 and a molecular weight of 554.74 g/mol. Its IUPAC name is 2-[4-[2-[4-[2-[(1Z)-buta-1,3-dienyl]phenyl]phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[4-[2-[4-[2-[(1Z)-buta-1,3-dienyl]phenyl]phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 146384699 |
| Molecular Formula | C41H34N2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 2-[4-[2-[4-[2-[(1Z)-buta-1,3-dienyl]phenyl]phenyl]propan-2-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | C=C/C=C\c1ccccc1-c1ccc(C(C)(C)c2ccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C41H34N2/c1-4-5-14-30-15-12-13-20-37(30)31-21-25-35(26-22-31)41(2,3)36-27-23-34(24-28-36)40-42-38(32-16-8-6-9-17-32)29-39(43-40)33-18-10-7-11-19-33/h4-29H,1H2,2-3H3/b14-5- |
| InChIKey | HJAGVFGQNUROSC-RZNTYIFUSA-N |
| XLogP | 10.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|