C42H33N3 — CID 121315550
2,4-diphenyl-6-[4-[2-[4-(4-phenylphenyl)phenyl]propan-2-yl]phenyl]-1,3,5-triazine (PubChem CID 121315550) has the molecular formula C42H33N3 and a molecular weight of 579.75 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[2-[4-(4-phenylphenyl)phenyl]propan-2-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[2-[4-(4-phenylphenyl)phenyl]propan-2-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 121315550 |
| Molecular Formula | C42H33N3 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 2,4-diphenyl-6-[4-[2-[4-(4-phenylphenyl)phenyl]propan-2-yl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(c1ccc(-c2ccc(-c3ccccc3)cc2)cc1)c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C42H33N3/c1-42(2,37-26-22-33(23-27-37)32-20-18-31(19-21-32)30-12-6-3-7-13-30)38-28-24-36(25-29-38)41-44-39(34-14-8-4-9-15-34)43-40(45-41)35-16-10-5-11-17-35/h3-29H,1-2H3 |
| InChIKey | BSFLFNBJGXPOQP-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |