C46H42N4 — CID 67334150
2,4-bis(4-tert-butylphenyl)-6-[4-[4-(5-phenyl-2-pyridinyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 67334150) has the molecular formula C46H42N4 and a molecular weight of 650.87 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[4-[4-(5-phenyl-2-pyridinyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[4-[4-(5-phenyl-2-pyridinyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 67334150 |
| Molecular Formula | C46H42N4 |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[4-[4-(5-phenyl-2-pyridinyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(-c4ccc(-c5ccc(-c6ccccc6)cn5)cc4)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C46H42N4/c1-45(2,3)39-25-20-36(21-26-39)43-48-42(49-44(50-43)37-22-27-40(28-23-37)46(4,5)6)35-18-14-33(15-19-35)32-12-16-34(17-13-32)41-29-24-38(30-47-41)31-10-8-7-9-11-31/h7-30H,1-6H3 |
| InChIKey | DPUXXRNDYOBNMI-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |