C26H17BN4 — CID 145132508
CID 145132508 (PubChem CID 145132508) has the molecular formula C26H17BN4 and a molecular weight of 396.26 g/mol.
| Compound Name | CID 145132508 |
|---|---|
| PubChem CID | 145132508 |
| Molecular Formula | C26H17BN4 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cn2)cc1 |
| InChI | InChI=1S/C26H17BN4/c27-22-14-11-18(12-15-22)23-16-13-21(17-28-23)26-30-24(19-7-3-1-4-8-19)29-25(31-26)20-9-5-2-6-10-20/h1-17H |
| InChIKey | QXBBOONIEPGMJN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|