C47H36N2 — CID 121315664
4-[4-[2-(4-naphthalen-2-ylphenyl)propan-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine (PubChem CID 121315664) has the molecular formula C47H36N2 and a molecular weight of 628.82 g/mol. Its IUPAC name is 4-[4-[2-(4-naphthalen-2-ylphenyl)propan-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[4-[2-(4-naphthalen-2-ylphenyl)propan-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 121315664 |
| Molecular Formula | C47H36N2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | 4-[4-[2-(4-naphthalen-2-ylphenyl)propan-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine |
| SMILES | CC(C)(c1ccc(-c2ccc3ccccc3c2)cc1)c1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C47H36N2/c1-47(2,42-27-23-36(24-28-42)41-22-19-34-13-9-10-16-40(34)31-41)43-29-25-38(26-30-43)45-32-44(48-46(49-45)39-14-7-4-8-15-39)37-20-17-35(18-21-37)33-11-5-3-6-12-33/h3-32H,1-2H3 |
| InChIKey | WVDWBNUFKVUSMM-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |