C42H39N3 — CID 146654325
3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole (PubChem CID 146654325) has the molecular formula C42H39N3 and a molecular weight of 585.80 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 146654325 |
| Molecular Formula | C42H39N3 |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C42H39N3/c1-41(2,3)31-19-23-38-34(25-31)35-26-32(42(4,5)6)20-24-39(35)45(38)33-21-17-30(18-22-33)40-43-36(28-13-9-7-10-14-28)27-37(44-40)29-15-11-8-12-16-29/h7-27H,1-6H3 |
| InChIKey | RZCPUVPQQTYRHV-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |