C53H46N4 — CID 140903129
3,6-ditert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-diphenylphenyl]carbazole (PubChem CID 140903129) has the molecular formula C53H46N4 and a molecular weight of 738.98 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-diphenylphenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-diphenylphenyl]carbazole |
|---|---|
| PubChem CID | 140903129 |
| Molecular Formula | C53H46N4 |
| Molecular Weight | 738.98 g/mol |
| Exact Mass | 738.37 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,5-diphenylphenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(-c2ccccc2)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C53H46N4/c1-52(2,3)39-27-29-46-44(31-39)45-32-40(53(4,5)6)28-30-47(45)57(46)41-33-42(35-19-11-7-12-20-35)48(43(34-41)36-21-13-8-14-22-36)51-55-49(37-23-15-9-16-24-37)54-50(56-51)38-25-17-10-18-26-38/h7-34H,1-6H3 |
| InChIKey | OAVOIOZWQMHFHG-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.98 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |