C56H47N7 — CID 149127050
9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole (PubChem CID 149127050) has the molecular formula C56H47N7 and a molecular weight of 818.04 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole.
| Compound Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole |
|---|---|
| PubChem CID | 149127050 |
| Molecular Formula | C56H47N7 |
| Molecular Weight | 818.04 g/mol |
| Exact Mass | 817.39 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C56H47N7/c1-55(2,3)40-30-32-46-44(34-40)45-35-41(56(4,5)6)31-33-47(45)63(46)48-42(53-59-49(36-20-11-7-12-21-36)57-50(60-53)37-22-13-8-14-23-37)28-19-29-43(48)54-61-51(38-24-15-9-16-25-38)58-52(62-54)39-26-17-10-18-27-39/h7-35H,1-6H3 |
| InChIKey | RBCJWAZYFQFTAU-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.04 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |