C59H48N4O — CID 146280466
3,6-ditert-butyl-9-[4-(4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole (PubChem CID 146280466) has the molecular formula C59H48N4O and a molecular weight of 829.06 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-(4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-(4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole |
|---|---|
| PubChem CID | 146280466 |
| Molecular Formula | C59H48N4O |
| Molecular Weight | 829.06 g/mol |
| Exact Mass | 828.38 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-(4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccccc3)nc(-c3cccc4oc5ccccc5c34)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C59H48N4O/c1-58(2,3)41-29-31-49-47(35-41)48-36-42(59(4,5)6)30-32-50(48)63(49)54-45(37-19-10-7-11-20-37)33-40(34-46(54)38-21-12-8-13-22-38)56-60-55(39-23-14-9-15-24-39)61-57(62-56)44-26-18-28-52-53(44)43-25-16-17-27-51(43)64-52/h7-36H,1-6H3 |
| InChIKey | KNXYWKXDLQDVDV-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.06 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |