C46H41N5 — CID 142560218
3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-pyridin-4-ylphenyl]carbazole (PubChem CID 142560218) has the molecular formula C46H41N5 and a molecular weight of 663.87 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-pyridin-4-ylphenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-pyridin-4-ylphenyl]carbazole |
|---|---|
| PubChem CID | 142560218 |
| Molecular Formula | C46H41N5 |
| Molecular Weight | 663.87 g/mol |
| Exact Mass | 663.34 |
| IUPAC Name | 3,6-ditert-butyl-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-pyridin-4-ylphenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(-c2ccncc2)cccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C46H41N5/c1-45(2,3)33-20-22-39-37(28-33)38-29-34(46(4,5)6)21-23-40(38)51(39)41-35(30-24-26-47-27-25-30)18-13-19-36(41)44-49-42(31-14-9-7-10-15-31)48-43(50-44)32-16-11-8-12-17-32/h7-29H,1-6H3 |
| InChIKey | UZOAEFROZXBIMO-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.87 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |