C59H50N4 — CID 153459784
3,6-ditert-butyl-9-[4-(2,6-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 153459784) has the molecular formula C59H50N4 and a molecular weight of 815.08 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-(2,6-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-(2,6-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 153459784 |
| Molecular Formula | C59H50N4 |
| Molecular Weight | 815.08 g/mol |
| Exact Mass | 814.40 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-(2,6-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C59H50N4/c1-58(2,3)44-31-34-51-48(37-44)49-38-45(59(4,5)6)32-35-52(49)63(51)53-33-30-43(54-46(39-20-11-7-12-21-39)28-19-29-47(54)40-22-13-8-14-23-40)36-50(53)57-61-55(41-24-15-9-16-25-41)60-56(62-57)42-26-17-10-18-27-42/h7-38H,1-6H3 |
| InChIKey | WOYDQXHNOTTXRA-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.08 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |