C54H46N4 — CID 150821440
3-tert-butyl-9-[3-(3-tert-butylcarbazol-9-yl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole (PubChem CID 150821440) has the molecular formula C54H46N4 and a molecular weight of 750.99 g/mol. Its IUPAC name is 3-tert-butyl-9-[3-(3-tert-butylcarbazol-9-yl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole.
| Compound Name | 3-tert-butyl-9-[3-(3-tert-butylcarbazol-9-yl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 150821440 |
| Molecular Formula | C54H46N4 |
| Molecular Weight | 750.99 g/mol |
| Exact Mass | 750.37 |
| IUPAC Name | 3-tert-butyl-9-[3-(3-tert-butylcarbazol-9-yl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccccc1n2-c1cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-n2c3ccccc3c3cc(C(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C54H46N4/c1-53(2,3)38-25-27-50-44(31-38)42-21-13-15-23-48(42)57(50)40-29-37(47-34-46(35-17-9-7-10-18-35)55-52(56-47)36-19-11-8-12-20-36)30-41(33-40)58-49-24-16-14-22-43(49)45-32-39(54(4,5)6)26-28-51(45)58/h7-34H,1-6H3 |
| InChIKey | KKADJMCHKODCLH-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.99 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |