C64H46N8 — CID 142508189
9-[4-(3,6-dimethylcarbazol-9-yl)-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole (PubChem CID 142508189) has the molecular formula C64H46N8 and a molecular weight of 927.13 g/mol. Its IUPAC name is 9-[4-(3,6-dimethylcarbazol-9-yl)-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[4-(3,6-dimethylcarbazol-9-yl)-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 142508189 |
| Molecular Formula | C64H46N8 |
| Molecular Weight | 927.13 g/mol |
| Exact Mass | 926.38 |
| IUPAC Name | 9-[4-(3,6-dimethylcarbazol-9-yl)-2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-n2c3ccc(C)cc3c3cc(C)ccc32)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C64H46N8/c1-39-25-29-54-48(33-39)49-34-40(2)26-30-55(49)71(54)47-37-52(63-67-59(43-17-9-5-10-18-43)65-60(68-63)44-19-11-6-12-20-44)58(72-56-31-27-41(3)35-50(56)51-36-42(4)28-32-57(51)72)53(38-47)64-69-61(45-21-13-7-14-22-45)66-62(70-64)46-23-15-8-16-24-46/h5-38H,1-4H3 |
| InChIKey | UJGQZMBALPALMA-UHFFFAOYSA-N |
| XLogP | 15.49 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.13 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |