C59H44N4Si — CID 161291237
[2-[4-(3,6-dimethylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-triphenylsilane (PubChem CID 161291237) has the molecular formula C59H44N4Si and a molecular weight of 837.11 g/mol. Its IUPAC name is [2-[4-(3,6-dimethylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-triphenylsilane.
| Compound Name | [2-[4-(3,6-dimethylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 161291237 |
| Molecular Formula | C59H44N4Si |
| Molecular Weight | 837.11 g/mol |
| Exact Mass | 836.33 |
| IUPAC Name | [2-[4-(3,6-dimethylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-triphenylsilane |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(-c2ccccc2[Si](c2ccccc2)(c2ccccc2)c2ccccc2)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C59H44N4Si/c1-41-32-36-54-51(38-41)52-39-42(2)33-37-55(52)63(54)45-34-35-49(53(40-45)59-61-57(43-20-8-3-9-21-43)60-58(62-59)44-22-10-4-11-23-44)50-30-18-19-31-56(50)64(46-24-12-5-13-25-46,47-26-14-6-15-27-47)48-28-16-7-17-29-48/h3-40H,1-2H3 |
| InChIKey | ZVQLUVRSITZGOL-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.11 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|