C86H57N7 — CID 137369176
9-[3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]-2-(2,6-diphenyl-4-pyridinyl)-6-phenylcarbazole (PubChem CID 137369176) has the molecular formula C86H57N7 and a molecular weight of 1188.45 g/mol. Its IUPAC name is 9-[3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]-2-(2,6-diphenyl-4-pyridinyl)-6-phenylcarbazole.
| Compound Name | 9-[3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]-2-(2,6-diphenyl-4-pyridinyl)-6-phenylcarbazole |
|---|---|
| PubChem CID | 137369176 |
| Molecular Formula | C86H57N7 |
| Molecular Weight | 1188.45 g/mol |
| Exact Mass | 1187.47 |
| IUPAC Name | 9-[3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]-2-(2,6-diphenyl-4-pyridinyl)-6-phenylcarbazole |
| SMILES | Cc1ccc2c(c1)c1ccccc1n2-c1c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc(-n2c3ccc(-c4ccccc4)cc3c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)cc32)cc1-c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C86H57N7/c1-56-41-45-82-70(47-56)68-39-23-24-40-80(68)93(82)84-72(85-88-76(60-31-15-5-16-32-60)54-77(89-85)61-33-17-6-18-34-61)52-67(53-73(84)86-90-78(62-35-19-7-20-36-62)55-79(91-86)63-37-21-8-22-38-63)92-81-46-43-64(57-25-9-2-10-26-57)48-71(81)69-44-42-65(51-83(69)92)66-49-74(58-27-11-3-12-28-58)87-75(50-66)59-29-13-4-14-30-59/h2-55H,1H3 |
| InChIKey | AIHPODKZJWLLES-UHFFFAOYSA-N |
| XLogP | 21.83 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1188.45 |
| LogP ≤ 5 | 21.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |