C33H33NO — CID 176670415
2,7-ditert-butyl-10-(4-phenylphenyl)acridin-9-one (PubChem CID 176670415) has the molecular formula C33H33NO and a molecular weight of 459.63 g/mol. Its IUPAC name is 2,7-ditert-butyl-10-(4-phenylphenyl)acridin-9-one.
| Compound Name | 2,7-ditert-butyl-10-(4-phenylphenyl)acridin-9-one |
|---|---|
| PubChem CID | 176670415 |
| Molecular Formula | C33H33NO |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 2,7-ditert-butyl-10-(4-phenylphenyl)acridin-9-one |
| SMILES | CC(C)(C)c1ccc2c(c1)c(=O)c1cc(C(C)(C)C)ccc1n2-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H33NO/c1-32(2,3)24-14-18-29-27(20-24)31(35)28-21-25(33(4,5)6)15-19-30(28)34(29)26-16-12-23(13-17-26)22-10-8-7-9-11-22/h7-21H,1-6H3 |
| InChIKey | OOBQDSFNFKOAMG-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|