C58H56N2O4 — CID 118655447
1,4-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]furo[3,4-c]furan-3,6-dione (PubChem CID 118655447) has the molecular formula C58H56N2O4 and a molecular weight of 845.10 g/mol. Its IUPAC name is 1,4-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]furo[3,4-c]furan-3,6-dione.
| Compound Name | 1,4-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]furo[3,4-c]furan-3,6-dione |
|---|---|
| PubChem CID | 118655447 |
| Molecular Formula | C58H56N2O4 |
| Molecular Weight | 845.10 g/mol |
| Exact Mass | 844.42 |
| IUPAC Name | 1,4-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]furo[3,4-c]furan-3,6-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(C2=C3C(=O)OC(c4ccc(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)cc4)=C3C(=O)O2)cc1 |
| InChI | InChI=1S/C58H56N2O4/c1-55(2,3)35-17-25-45-41(29-35)42-30-36(56(4,5)6)18-26-46(42)59(45)39-21-13-33(14-22-39)51-49-50(54(62)63-51)52(64-53(49)61)34-15-23-40(24-16-34)60-47-27-19-37(57(7,8)9)31-43(47)44-32-38(58(10,11)12)20-28-48(44)60/h13-32H,1-12H3 |
| InChIKey | MPZCWVZRMYEBRF-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.10 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|